C22H33N — CID 122548330
N-(1-adamantylmethyl)-N-methyl-1-(4-propan-2-ylphenyl)methanamine (PubChem CID 122548330) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-methyl-1-(4-propan-2-ylphenyl)methanamine.
| Compound Name | N-(1-adamantylmethyl)-N-methyl-1-(4-propan-2-ylphenyl)methanamine |
|---|---|
| PubChem CID | 122548330 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | N-(1-adamantylmethyl)-N-methyl-1-(4-propan-2-ylphenyl)methanamine |
| SMILES | CC(C)c1ccc(CN(C)CC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H33N/c1-16(2)21-6-4-17(5-7-21)14-23(3)15-22-11-18-8-19(12-22)10-20(9-18)13-22/h4-7,16,18-20H,8-15H2,1-3H3 |
| InChIKey | GRPCTRSGKKEVOB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |