C26H30N3O2+ — CID 72986946
N-[1-[2-(1-adamantyl)-2-oxoethyl]pyridin-1-ium-4-yl]-3-(4-aminophenyl)prop-2-enamide (PubChem CID 72986946) has the molecular formula C26H30N3O2+ and a molecular weight of 416.55 g/mol. Its IUPAC name is N-[1-[2-(1-adamantyl)-2-oxoethyl]pyridin-1-ium-4-yl]-3-(4-aminophenyl)prop-2-enamide.
| Compound Name | N-[1-[2-(1-adamantyl)-2-oxoethyl]pyridin-1-ium-4-yl]-3-(4-aminophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 72986946 |
| Molecular Formula | C26H30N3O2+ |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | N-[1-[2-(1-adamantyl)-2-oxoethyl]pyridin-1-ium-4-yl]-3-(4-aminophenyl)prop-2-enamide |
| SMILES | Nc1ccc(C=CC(=O)Nc2cc[n+](CC(=O)C34CC5CC(CC(C5)C3)C4)cc2)cc1 |
| InChI | InChI=1S/C26H29N3O2/c27-22-4-1-18(2-5-22)3-6-25(31)28-23-7-9-29(10-8-23)17-24(30)26-14-19-11-20(15-26)13-21(12-19)16-26/h1-10,19-21H,11-17H2,(H2,27,31)/p+1 |
| InChIKey | VMERPNWXLDPGOP-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|