C38H38N6O2+2 — CID 73456791
(E)-3-[4-[(E)-3-[4-[(1-ethylpyridin-1-ium-4-yl)amino]anilino]-3-oxoprop-1-enyl]phenyl]-N-[4-[(1-ethylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 73456791) has the molecular formula C38H38N6O2+2 and a molecular weight of 610.76 g/mol. Its IUPAC name is (E)-3-[4-[(E)-3-[4-[(1-ethylpyridin-1-ium-4-yl)amino]anilino]-3-oxoprop-1-enyl]phenyl]-N-[4-[(1-ethylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(E)-3-[4-[(1-ethylpyridin-1-ium-4-yl)amino]anilino]-3-oxoprop-1-enyl]phenyl]-N-[4-[(1-ethylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 73456791 |
| Molecular Formula | C38H38N6O2+2 |
| Molecular Weight | 610.76 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | (E)-3-[4-[(E)-3-[4-[(1-ethylpyridin-1-ium-4-yl)amino]anilino]-3-oxoprop-1-enyl]phenyl]-N-[4-[(1-ethylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | CC[n+]1ccc(Nc2ccc(NC(=O)/C=C/c3ccc(/C=C/C(=O)Nc4ccc(Nc5cc[n+](CC)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H36N6O2/c1-3-43-25-21-35(22-26-43)39-31-11-15-33(16-12-31)41-37(45)19-9-29-5-7-30(8-6-29)10-20-38(46)42-34-17-13-32(14-18-34)40-36-23-27-44(4-2)28-24-36/h5-28H,3-4H2,1-2H3,(H2,41,42,45,46)/p+2/b19-9+,20-10+ |
| InChIKey | VVZFPHQAKLSFJM-LQGKIZFRSA-P |
| XLogP | 7.09 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|