C31H30N6O+2 — CID 6444880
(E)-3-[4-[(6-amino-1-methylquinolin-1-ium-4-yl)amino]phenyl]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide (PubChem CID 6444880) has the molecular formula C31H30N6O+2 and a molecular weight of 502.62 g/mol. Its IUPAC name is (E)-3-[4-[(6-amino-1-methylquinolin-1-ium-4-yl)amino]phenyl]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(6-amino-1-methylquinolin-1-ium-4-yl)amino]phenyl]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6444880 |
| Molecular Formula | C31H30N6O+2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (E)-3-[4-[(6-amino-1-methylquinolin-1-ium-4-yl)amino]phenyl]-N-[4-[(1-methylpyridin-1-ium-4-yl)amino]phenyl]prop-2-enamide |
| SMILES | C[n+]1ccc(Nc2ccc(NC(=O)/C=C/c3ccc(Nc4cc[n+](C)c5ccc(N)cc45)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H28N6O/c1-36-18-15-27(16-19-36)33-24-9-11-26(12-10-24)35-31(38)14-5-22-3-7-25(8-4-22)34-29-17-20-37(2)30-13-6-23(32)21-28(29)30/h3-21H,32H2,1-2H3,(H,35,38)/p+2/b14-5+ |
| InChIKey | GJOMYKUNIVZPJD-LHHJGKSTSA-P |
| XLogP | 5.21 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|