C28H28F6N2O5 — CID 155168746
2-[3,5-bis(trifluoromethyl)phenyl]ethyl-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid (PubChem CID 155168746) has the molecular formula C28H28F6N2O5 and a molecular weight of 586.53 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
|---|---|
| PubChem CID | 155168746 |
| Molecular Formula | C28H28F6N2O5 |
| Molecular Weight | 586.53 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]ethyl-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2N(CCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)O)NOC1CCCCO1 |
| InChI | InChI=1S/C28H28F6N2O5/c29-27(30,31)20-14-18(15-21(16-20)28(32,33)34)10-11-36(26(38)39)23-8-6-19-13-17(4-7-22(19)23)5-9-24(37)35-41-25-3-1-2-12-40-25/h4-5,7,9,13-16,23,25H,1-3,6,8,10-12H2,(H,35,37)(H,38,39)/b9-5+ |
| InChIKey | ZQRHULZPVQDCCV-WEVVVXLNSA-N |
| XLogP | 6.52 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|