C18H22N2O5 — CID 175182544
[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid (PubChem CID 175182544) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is [5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid.
| Compound Name | [5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
|---|---|
| PubChem CID | 175182544 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamic acid |
| SMILES | O=C(O)NC1CCc2cc(/C=C/C(=O)NOC3CCCCO3)ccc21 |
| InChI | InChI=1S/C18H22N2O5/c21-16(20-25-17-3-1-2-10-24-17)9-5-12-4-7-14-13(11-12)6-8-15(14)19-18(22)23/h4-5,7,9,11,15,17,19H,1-3,6,8,10H2,(H,20,21)(H,22,23)/b9-5+ |
| InChIKey | VRQUDLRAHTZKAB-WEVVVXLNSA-N |
| XLogP | 2.53 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|