C13H15NO5S — CID 74828602
5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]thiophene-2-carboxylic acid (PubChem CID 74828602) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 74828602 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 5-[3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]thiophene-2-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(C(=O)O)s1)NOC1CCCCO1 |
| InChI | InChI=1S/C13H15NO5S/c15-11(14-19-12-3-1-2-8-18-12)7-5-9-4-6-10(20-9)13(16)17/h4-7,12H,1-3,8H2,(H,14,15)(H,16,17) |
| InChIKey | CEIAEIPOXAMIHO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|