C26H26F6N2O3 — CID 155181037
(E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2,3-dihydro-1H-inden-5-yl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 155181037) has the molecular formula C26H26F6N2O3 and a molecular weight of 528.49 g/mol. Its IUPAC name is (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2,3-dihydro-1H-inden-5-yl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2,3-dihydro-1H-inden-5-yl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 155181037 |
| Molecular Formula | C26H26F6N2O3 |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (E)-3-[1-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-2,3-dihydro-1H-inden-5-yl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C26H26F6N2O3/c27-25(28,29)19-12-17(13-20(14-19)26(30,31)32)15-33-22-8-6-18-11-16(4-7-21(18)22)5-9-23(35)34-37-24-3-1-2-10-36-24/h4-5,7,9,11-14,22,24,33H,1-3,6,8,10,15H2,(H,34,35)/b9-5+ |
| InChIKey | DXHMRDALHYLSAA-WEVVVXLNSA-N |
| XLogP | 6.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|