C22H19F6NO3 — CID 155181080
(E)-3-[5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-hydroxyprop-2-enamide (PubChem CID 155181080) has the molecular formula C22H19F6NO3 and a molecular weight of 459.39 g/mol. Its IUPAC name is (E)-3-[5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 155181080 |
| Molecular Formula | C22H19F6NO3 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (E)-3-[5-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-5,6,7,8-tetrahydronaphthalen-2-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCCC2OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C22H19F6NO3/c23-21(24,25)16-9-14(10-17(11-16)22(26,27)28)12-32-19-3-1-2-15-8-13(4-6-18(15)19)5-7-20(30)29-31/h4-11,19,31H,1-3,12H2,(H,29,30)/b7-5+ |
| InChIKey | MQLOQRQMUKPRML-FNORWQNLSA-N |
| XLogP | 5.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|