C23H19F6NO3 — CID 165012858
N-[6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 165012858) has the molecular formula C23H19F6NO3 and a molecular weight of 471.40 g/mol. Its IUPAC name is N-[6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 165012858 |
| Molecular Formula | C23H19F6NO3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | N-[6-[(E)-4-hydroxy-3-oxobut-1-enyl]-1,2,3,4-tetrahydronaphthalen-1-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCCC2NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)CO |
| InChI | InChI=1S/C23H19F6NO3/c24-22(25,26)16-9-15(10-17(11-16)23(27,28)29)21(33)30-20-3-1-2-14-8-13(5-7-19(14)20)4-6-18(32)12-31/h4-11,20,31H,1-3,12H2,(H,30,33)/b6-4+ |
| InChIKey | LCQKZADZIGZPHO-GQCTYLIASA-N |
| XLogP | 5.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|