C29H29F6N3O6 — CID 159684811
[3-[3,5-bis(trifluoromethyl)anilino]-3-oxopropyl] N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 159684811) has the molecular formula C29H29F6N3O6 and a molecular weight of 629.55 g/mol. Its IUPAC name is [3-[3,5-bis(trifluoromethyl)anilino]-3-oxopropyl] N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | [3-[3,5-bis(trifluoromethyl)anilino]-3-oxopropyl] N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 159684811 |
| Molecular Formula | C29H29F6N3O6 |
| Molecular Weight | 629.55 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | [3-[3,5-bis(trifluoromethyl)anilino]-3-oxopropyl] N-[5-[(E)-3-(oxan-2-yloxyamino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | O=C(/C=C/c1ccc2c(c1)CCC2NC(=O)OCCC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NOC1CCCCO1 |
| InChI | InChI=1S/C29H29F6N3O6/c30-28(31,32)19-14-20(29(33,34)35)16-21(15-19)36-24(39)10-12-43-27(41)37-23-8-6-18-13-17(4-7-22(18)23)5-9-25(40)38-44-26-3-1-2-11-42-26/h4-5,7,9,13-16,23,26H,1-3,6,8,10-12H2,(H,36,39)(H,37,41)(H,38,40)/b9-5+ |
| InChIKey | MVQPMOKHGCZYRG-WEVVVXLNSA-N |
| XLogP | 6.05 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|