C27H20F7N3O2 — CID 155168303
N-[5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 155168303) has the molecular formula C27H20F7N3O2 and a molecular weight of 551.46 g/mol. Its IUPAC name is N-[5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 155168303 |
| Molecular Formula | C27H20F7N3O2 |
| Molecular Weight | 551.46 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | N-[5-[(E)-3-(2-amino-4-fluoroanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Nc1cc(F)ccc1NC(=O)/C=C/c1ccc2c(c1)CCC2NC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H20F7N3O2/c28-19-4-7-23(21(35)13-19)36-24(38)8-2-14-1-5-20-15(9-14)3-6-22(20)37-25(39)16-10-17(26(29,30)31)12-18(11-16)27(32,33)34/h1-2,4-5,7-13,22H,3,6,35H2,(H,36,38)(H,37,39)/b8-2+ |
| InChIKey | DRUIMWCGDOXZEB-KRXBUXKQSA-N |
| XLogP | 6.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|