C19H16F2N2O2 — CID 35504273
N-cyclopropyl-4-[(E)-3-(2,5-difluoroanilino)-3-oxoprop-1-enyl]benzamide (PubChem CID 35504273) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-(2,5-difluoroanilino)-3-oxoprop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-(2,5-difluoroanilino)-3-oxoprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 35504273 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-(2,5-difluoroanilino)-3-oxoprop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NC2CC2)cc1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C19H16F2N2O2/c20-14-6-9-16(21)17(11-14)23-18(24)10-3-12-1-4-13(5-2-12)19(25)22-15-7-8-15/h1-6,9-11,15H,7-8H2,(H,22,25)(H,23,24)/b10-3+ |
| InChIKey | QCVXUWNKHCXLSF-XCVCLJGOSA-N |
| XLogP | 3.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|