C20H17F3N2O3 — CID 35750831
N-cyclopropyl-4-[(E)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-enyl]benzamide (PubChem CID 35750831) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is N-cyclopropyl-4-[(E)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-enyl]benzamide.
| Compound Name | N-cyclopropyl-4-[(E)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 35750831 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | N-cyclopropyl-4-[(E)-3-oxo-3-[2-(trifluoromethoxy)anilino]prop-1-enyl]benzamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)NC2CC2)cc1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H17F3N2O3/c21-20(22,23)28-17-4-2-1-3-16(17)25-18(26)12-7-13-5-8-14(9-6-13)19(27)24-15-10-11-15/h1-9,12,15H,10-11H2,(H,24,27)(H,25,26)/b12-7+ |
| InChIKey | IZTASNAEEDDOQK-KPKJPENVSA-N |
| XLogP | 4.13 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|