C17H14F3NO3 — CID 16572166
(E)-3-(3-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 16572166) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is (E)-3-(3-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16572166 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (E)-3-(3-methoxyphenyl)-N-[2-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccccc2OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3NO3/c1-23-13-6-4-5-12(11-13)9-10-16(22)21-14-7-2-3-8-15(14)24-17(18,19)20/h2-11H,1H3,(H,21,22)/b10-9+ |
| InChIKey | MIQYTJFNCMLUOX-MDZDMXLPSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|