C20H17F6N2O2+ — CID 155703784
[5-[(E)-3-amino-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[3,5-bis(trifluoromethyl)phenoxy]azanium (PubChem CID 155703784) has the molecular formula C20H17F6N2O2+ and a molecular weight of 431.36 g/mol. Its IUPAC name is [5-[(E)-3-amino-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[3,5-bis(trifluoromethyl)phenoxy]azanium.
| Compound Name | [5-[(E)-3-amino-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[3,5-bis(trifluoromethyl)phenoxy]azanium |
|---|---|
| PubChem CID | 155703784 |
| Molecular Formula | C20H17F6N2O2+ |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [5-[(E)-3-amino-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]-[3,5-bis(trifluoromethyl)phenoxy]azanium |
| SMILES | NC(=O)/C=C/c1ccc2c(c1)CCC2[NH2+]Oc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H16F6N2O2/c21-19(22,23)13-8-14(20(24,25)26)10-15(9-13)30-28-17-5-3-12-7-11(1-4-16(12)17)2-6-18(27)29/h1-2,4,6-10,17,28H,3,5H2,(H2,27,29)/p+1/b6-2+ |
| InChIKey | OKPXMLWDMNJEFZ-QHHAFSJGSA-O |
| XLogP | 3.77 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|