C10H14O — CID 91026557
1,2,3,4,4a,5-hexahydronaphthalen-1-ol (PubChem CID 91026557) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydronaphthalen-1-ol.
| Compound Name | 1,2,3,4,4a,5-hexahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 91026557 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydronaphthalen-1-ol |
| SMILES | OC1CCCC2CC=CC=C12 |
| InChI | InChI=1S/C10H14O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,6,8,10-11H,3-5,7H2 |
| InChIKey | XMBLETGTABVBTD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |