C12H18O — CID 173193560
2-cyclohexylcyclohexa-2,4-dien-1-ol (PubChem CID 173193560) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-cyclohexylcyclohexa-2,4-dien-1-ol.
| Compound Name | 2-cyclohexylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 173193560 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-cyclohexylcyclohexa-2,4-dien-1-ol |
| SMILES | OC1CC=CC=C1C1CCCCC1 |
| InChI | InChI=1S/C12H18O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h4-5,8,10,12-13H,1-3,6-7,9H2 |
| InChIKey | JSNOPHSDRPNODV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |