C16H26 — CID 154370011
1-cyclooctylcycloocta-1,3-diene (PubChem CID 154370011) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-cyclooctylcycloocta-1,3-diene.
| Compound Name | 1-cyclooctylcycloocta-1,3-diene |
|---|---|
| PubChem CID | 154370011 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-cyclooctylcycloocta-1,3-diene |
| SMILES | C1=CCCCCC(C2CCCCCCC2)=C1 |
| InChI | InChI=1S/C16H26/c1-3-7-11-15(12-8-4-1)16-13-9-5-2-6-10-14-16/h3,7,11,16H,1-2,4-6,8-10,12-14H2 |
| InChIKey | CJGYJNZYOFIEPG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |