C13H16Co — CID 159396232
cobalt;1-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene (PubChem CID 159396232) has the molecular formula C13H16Co and a molecular weight of 231.20 g/mol. Its IUPAC name is cobalt;1-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene.
| Compound Name | cobalt;1-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene |
|---|---|
| PubChem CID | 159396232 |
| Molecular Formula | C13H16Co |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | cobalt;1-cyclopenta-2,4-dien-1-ylcycloocta-1,3-diene |
| SMILES | C1=CCCCCC(C2C=CC=C2)=C1.[Co] |
| InChI | InChI=1S/C13H16.Co/c1-2-4-8-12(9-5-3-1)13-10-6-7-11-13;/h2,4,6-8,10-11,13H,1,3,5,9H2; |
| InChIKey | LMTDMBPFNXSJRM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |