C12H14 — CID 153393902
1-[(1S)-cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene (PubChem CID 153393902) has the molecular formula C12H14 and a molecular weight of 158.24 g/mol. Its IUPAC name is 1-[(1S)-cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene.
| Compound Name | 1-[(1S)-cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 153393902 |
| Molecular Formula | C12H14 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 1-[(1S)-cyclohexa-2,4-dien-1-yl]cyclohexa-1,3-diene |
| SMILES | C1=CCCC([C@@H]2C=CC=CC2)=C1 |
| InChI | InChI=1S/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-5,7,9,11H,6,8,10H2/t11-/m1/s1 |
| InChIKey | XYQOCPPODVAVRC-LLVKDONJSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |