C12H15N — CID 135218026
2-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-amine (PubChem CID 135218026) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | 2-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 135218026 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-ylcyclohexa-2,4-dien-1-amine |
| SMILES | NC1CC=CC=C1C1=CC=CCC1 |
| InChI | InChI=1S/C12H15N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-2,4-6,8,12H,3,7,9,13H2 |
| InChIKey | ZXPGVGMRNJEFND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |