C13H12O — CID 89145336
4-cyclohexa-1,3-dien-1-ylbenzaldehyde (PubChem CID 89145336) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-cyclohexa-1,3-dien-1-ylbenzaldehyde.
| Compound Name | 4-cyclohexa-1,3-dien-1-ylbenzaldehyde |
|---|---|
| PubChem CID | 89145336 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 4-cyclohexa-1,3-dien-1-ylbenzaldehyde |
| SMILES | O=Cc1ccc(C2=CC=CCC2)cc1 |
| InChI | InChI=1S/C13H12O/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-2,4,6-10H,3,5H2 |
| InChIKey | QYDVZKRYJRZVSA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|