C17H16 — CID 143516751
2-cyclohexa-1,3-dien-1-yl-6-methylnaphthalene (PubChem CID 143516751) has the molecular formula C17H16 and a molecular weight of 220.31 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-6-methylnaphthalene.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-6-methylnaphthalene |
|---|---|
| PubChem CID | 143516751 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-6-methylnaphthalene |
| SMILES | Cc1ccc2cc(C3=CC=CCC3)ccc2c1 |
| InChI | InChI=1S/C17H16/c1-13-7-8-17-12-16(10-9-15(17)11-13)14-5-3-2-4-6-14/h2-3,5,7-12H,4,6H2,1H3 |
| InChIKey | JQYXZXQUZZFCSY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |