C21H20 — CID 142381891
2-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluorene (PubChem CID 142381891) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluorene.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 142381891 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluorene |
| SMILES | CC1(C)c2ccccc2-c2ccc(C3=CC=CCC3)cc21 |
| InChI | InChI=1S/C21H20/c1-21(2)19-11-7-6-10-17(19)18-13-12-16(14-20(18)21)15-8-4-3-5-9-15/h3-4,6-8,10-14H,5,9H2,1-2H3 |
| InChIKey | KSGYNKQWANMPMH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |