C21H21N — CID 135162890
N-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluoren-2-amine (PubChem CID 135162890) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluoren-2-amine.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 135162890 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-9,9-dimethylfluoren-2-amine |
| SMILES | CC1(C)c2ccccc2-c2ccc(NC3=CC=CCC3)cc21 |
| InChI | InChI=1S/C21H21N/c1-21(2)19-11-7-6-10-17(19)18-13-12-16(14-20(18)21)22-15-8-4-3-5-9-15/h3-4,6-8,10-14,22H,5,9H2,1-2H3 |
| InChIKey | AHXWUGXCFQHVQG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |