C18H17N — CID 134504686
N-cyclohexa-1,3-dien-1-yl-4-phenylaniline (PubChem CID 134504686) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-4-phenylaniline.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-4-phenylaniline |
|---|---|
| PubChem CID | 134504686 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-4-phenylaniline |
| SMILES | C1=CCCC(Nc2ccc(-c3ccccc3)cc2)=C1 |
| InChI | InChI=1S/C18H17N/c1-3-7-15(8-4-1)16-11-13-18(14-12-16)19-17-9-5-2-6-10-17/h1-5,7-9,11-14,19H,6,10H2 |
| InChIKey | FDEWIUQTCAPZRM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |