C16H19N — CID 87249940
(1E,3Z,5Z)-N-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]cycloocta-1,3,5-trien-1-amine (PubChem CID 87249940) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is (1E,3Z,5Z)-N-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]cycloocta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-N-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]cycloocta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 87249940 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (1E,3Z,5Z)-N-[(1E,3Z,5Z)-cycloocta-1,3,5-trien-1-yl]cycloocta-1,3,5-trien-1-amine |
| SMILES | C1=C\C=C(\N/C2=C/C=C\C=C/CC2)CC\C=C/1 |
| InChI | InChI=1S/C16H19N/c1-3-7-11-15(12-8-4-1)17-16-13-9-5-2-6-10-14-16/h1-7,9,11,13,17H,8,10,12,14H2/b4-1-,6-2-,7-3-,9-5-,15-11+,16-13+ |
| InChIKey | CKDSGDLFELYFNY-IQXVCYOSSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |