C13H16N2 — CID 89086842
2-N-cyclohexa-1,3-dien-1-yl-4-methylbenzene-1,2-diamine (PubChem CID 89086842) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-N-cyclohexa-1,3-dien-1-yl-4-methylbenzene-1,2-diamine.
| Compound Name | 2-N-cyclohexa-1,3-dien-1-yl-4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 89086842 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-N-cyclohexa-1,3-dien-1-yl-4-methylbenzene-1,2-diamine |
| SMILES | Cc1ccc(N)c(NC2=CC=CCC2)c1 |
| InChI | InChI=1S/C13H16N2/c1-10-7-8-12(14)13(9-10)15-11-5-3-2-4-6-11/h2-3,5,7-9,15H,4,6,14H2,1H3 |
| InChIKey | MLFQJDJRFMLFRN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|