C10H18N2S — CID 142334544
ethane;4-methyl-2-N-methylsulfanylbenzene-1,2-diamine (PubChem CID 142334544) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is ethane;4-methyl-2-N-methylsulfanylbenzene-1,2-diamine.
| Compound Name | ethane;4-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 142334544 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | ethane;4-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
| SMILES | CC.CSNc1cc(C)ccc1N |
| InChI | InChI=1S/C8H12N2S.C2H6/c1-6-3-4-7(9)8(5-6)10-11-2;1-2/h3-5,10H,9H2,1-2H3;1-2H3 |
| InChIKey | CQUVAZSVQANZJE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|