C10H10ClN3O — CID 144841167
2-chloro-4-(cyclohexa-1,3-dien-1-ylamino)pyrimidin-5-ol (PubChem CID 144841167) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-chloro-4-(cyclohexa-1,3-dien-1-ylamino)pyrimidin-5-ol.
| Compound Name | 2-chloro-4-(cyclohexa-1,3-dien-1-ylamino)pyrimidin-5-ol |
|---|---|
| PubChem CID | 144841167 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-chloro-4-(cyclohexa-1,3-dien-1-ylamino)pyrimidin-5-ol |
| SMILES | Oc1cnc(Cl)nc1NC1=CC=CCC1 |
| InChI | InChI=1S/C10H10ClN3O/c11-10-12-6-8(15)9(14-10)13-7-4-2-1-3-5-7/h1-2,4,6,15H,3,5H2,(H,12,13,14) |
| InChIKey | CWKPLCHUKZOTJE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |