C10H7Cl2N3O — CID 150084740
4-[(2,5-dichloropyrimidin-4-yl)amino]phenol (PubChem CID 150084740) has the molecular formula C10H7Cl2N3O and a molecular weight of 256.09 g/mol. Its IUPAC name is 4-[(2,5-dichloropyrimidin-4-yl)amino]phenol.
| Compound Name | 4-[(2,5-dichloropyrimidin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 150084740 |
| Molecular Formula | C10H7Cl2N3O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | 4-[(2,5-dichloropyrimidin-4-yl)amino]phenol |
| SMILES | Oc1ccc(Nc2nc(Cl)ncc2Cl)cc1 |
| InChI | InChI=1S/C10H7Cl2N3O/c11-8-5-13-10(12)15-9(8)14-6-1-3-7(16)4-2-6/h1-5,16H,(H,13,14,15) |
| InChIKey | DRZKXJYGSBNXSA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|