2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid

C11H7Cl2N3O2 — CID 71501536

IUPAC2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid
SMILESO=C(O)c1ccccc1Nc1nc(Cl)ncc1Cl
InChIInChI=1S/C11H7Cl2N3O2/c12-7-5-14-11(13)16-9(7)15-8-4-2-1-3-6(8)10(17)18/h1-5H,(H,17,18)(H,14,15,16)
InChIKeyPLQUBFFHMJPIAO-UHFFFAOYSA-N
MW284.10 g/mol
LogP3.23
Rot. Bonds3

About 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid

2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid (PubChem CID 71501536) has the molecular formula C11H7Cl2N3O2 and a molecular weight of 284.10 g/mol. Its IUPAC name is 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid.

Molecular Properties

Compound Name2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid
PubChem CID71501536
Molecular FormulaC11H7Cl2N3O2
Molecular Weight284.10 g/mol
Exact Mass282.99
IUPAC Name2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid
SMILESO=C(O)c1ccccc1Nc1nc(Cl)ncc1Cl
InChIInChI=1S/C11H7Cl2N3O2/c12-7-5-14-11(13)16-9(7)15-8-4-2-1-3-6(8)10(17)18/h1-5H,(H,17,18)(H,14,15,16)
InChIKeyPLQUBFFHMJPIAO-UHFFFAOYSA-N
XLogP3.23
TPSA75.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.10
LogP ≤ 53.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid?
The IUPAC name of 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid (CID 71501536) is 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid.
What is the SMILES notation for 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid?
The canonical SMILES for 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid is O=C(O)c1ccccc1Nc1nc(Cl)ncc1Cl.
What is the InChIKey of 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid?
The InChIKey is PLQUBFFHMJPIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl2N3O2/c12-7-5-14-11(13)16-9(7)15-8-4-2-1-3-6(8)10(17)18/h1-5H,(H,17,18)(H,14,15,16).
What are the key properties of 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid?
2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid has a molecular weight of 284.10 g/mol, XLogP of 3.23, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid is sourced from PubChem (CID 71501536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).