C11H7Cl2N3O2 — CID 71501536
2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid (PubChem CID 71501536) has the molecular formula C11H7Cl2N3O2 and a molecular weight of 284.10 g/mol. Its IUPAC name is 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 71501536 |
| Molecular Formula | C11H7Cl2N3O2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C11H7Cl2N3O2/c12-7-5-14-11(13)16-9(7)15-8-4-2-1-3-6(8)10(17)18/h1-5H,(H,17,18)(H,14,15,16) |
| InChIKey | PLQUBFFHMJPIAO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |