C14H14Cl2N4O2S — CID 86633907
2,5-dichloro-N-(2-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-4-amine (PubChem CID 86633907) has the molecular formula C14H14Cl2N4O2S and a molecular weight of 373.27 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(2-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 86633907 |
| Molecular Formula | C14H14Cl2N4O2S |
| Molecular Weight | 373.27 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2,5-dichloro-N-(2-pyrrolidin-1-ylsulfonylphenyl)pyrimidin-4-amine |
| SMILES | O=S(=O)(c1ccccc1Nc1nc(Cl)ncc1Cl)N1CCCC1 |
| InChI | InChI=1S/C14H14Cl2N4O2S/c15-10-9-17-14(16)19-13(10)18-11-5-1-2-6-12(11)23(21,22)20-7-3-4-8-20/h1-2,5-6,9H,3-4,7-8H2,(H,17,18,19) |
| InChIKey | SZTOZZFAXADSOW-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |