C15H17ClN4O3S — CID 143003266
N-[5-chloro-4-(2-cyclopentylsulfonylanilino)pyrimidin-2-yl]hydroxylamine (PubChem CID 143003266) has the molecular formula C15H17ClN4O3S and a molecular weight of 368.85 g/mol. Its IUPAC name is N-[5-chloro-4-(2-cyclopentylsulfonylanilino)pyrimidin-2-yl]hydroxylamine.
| Compound Name | N-[5-chloro-4-(2-cyclopentylsulfonylanilino)pyrimidin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 143003266 |
| Molecular Formula | C15H17ClN4O3S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[5-chloro-4-(2-cyclopentylsulfonylanilino)pyrimidin-2-yl]hydroxylamine |
| SMILES | O=S(=O)(c1ccccc1Nc1nc(NO)ncc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H17ClN4O3S/c16-11-9-17-15(20-21)19-14(11)18-12-7-3-4-8-13(12)24(22,23)10-5-1-2-6-10/h3-4,7-10,21H,1-2,5-6H2,(H2,17,18,19,20) |
| InChIKey | WVZGOEXZJMFPPS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|