C13H12ClN5O2 — CID 143189469
7-[[5-chloro-2-(hydroxyamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one (PubChem CID 143189469) has the molecular formula C13H12ClN5O2 and a molecular weight of 305.73 g/mol. Its IUPAC name is 7-[[5-chloro-2-(hydroxyamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one.
| Compound Name | 7-[[5-chloro-2-(hydroxyamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 143189469 |
| Molecular Formula | C13H12ClN5O2 |
| Molecular Weight | 305.73 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 7-[[5-chloro-2-(hydroxyamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one |
| SMILES | CN1Cc2cccc(Nc3nc(NO)ncc3Cl)c2C1=O |
| InChI | InChI=1S/C13H12ClN5O2/c1-19-6-7-3-2-4-9(10(7)12(19)20)16-11-8(14)5-15-13(17-11)18-21/h2-5,21H,6H2,1H3,(H2,15,16,17,18) |
| InChIKey | JQSSIGAZSFAYAM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|