C21H26ClN7O2 — CID 59849181
4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-7-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one (PubChem CID 59849181) has the molecular formula C21H26ClN7O2 and a molecular weight of 443.94 g/mol. Its IUPAC name is 4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-7-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one.
| Compound Name | 4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-7-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 59849181 |
| Molecular Formula | C21H26ClN7O2 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-[(9aR)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-7-[[5-chloro-2-(methylamino)pyrimidin-4-yl]amino]-2-methyl-3H-isoindol-1-one |
| SMILES | CNc1ncc(Cl)c(Nc2ccc(N3CCN4CCOC[C@H]4C3)c3c2C(=O)N(C)C3)n1 |
| InChI | InChI=1S/C21H26ClN7O2/c1-23-21-24-9-15(22)19(26-21)25-16-3-4-17(14-11-27(2)20(30)18(14)16)29-6-5-28-7-8-31-12-13(28)10-29/h3-4,9,13H,5-8,10-12H2,1-2H3,(H2,23,24,25,26)/t13-/m1/s1 |
| InChIKey | VLUQQMPZTUHMOO-CYBMUJFWSA-N |
| XLogP | 2.02 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |