C28H31F3N7O5P — CID 67480337
[4-[[4-[[7-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methylphosphonic acid (PubChem CID 67480337) has the molecular formula C28H31F3N7O5P and a molecular weight of 633.57 g/mol. Its IUPAC name is [4-[[4-[[7-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methylphosphonic acid.
| Compound Name | [4-[[4-[[7-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 67480337 |
| Molecular Formula | C28H31F3N7O5P |
| Molecular Weight | 633.57 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | [4-[[4-[[7-(3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl)-2-methyl-3-oxo-1H-isoindol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methylphosphonic acid |
| SMILES | CN1Cc2c(N3CCN4CCOCC4C3)ccc(Nc3nc(Nc4ccc(CP(=O)(O)O)cc4)ncc3C(F)(F)F)c2C1=O |
| InChI | InChI=1S/C28H31F3N7O5P/c1-36-14-20-23(38-9-8-37-10-11-43-15-19(37)13-38)7-6-22(24(20)26(36)39)34-25-21(28(29,30)31)12-32-27(35-25)33-18-4-2-17(3-5-18)16-44(40,41)42/h2-7,12,19H,8-11,13-16H2,1H3,(H2,40,41,42)(H2,32,33,34,35) |
| InChIKey | GKVVXUDBKAGIMI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|