C28H33F3N5O7P — CID 58292959
7-[[4-[4-[bis(2-methoxyethoxy)phosphorylmethyl]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-methyl-3H-isoindol-1-one (PubChem CID 58292959) has the molecular formula C28H33F3N5O7P and a molecular weight of 639.57 g/mol. Its IUPAC name is 7-[[4-[4-[bis(2-methoxyethoxy)phosphorylmethyl]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-methyl-3H-isoindol-1-one.
| Compound Name | 7-[[4-[4-[bis(2-methoxyethoxy)phosphorylmethyl]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 58292959 |
| Molecular Formula | C28H33F3N5O7P |
| Molecular Weight | 639.57 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | 7-[[4-[4-[bis(2-methoxyethoxy)phosphorylmethyl]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-methyl-3H-isoindol-1-one |
| SMILES | COCCOP(=O)(Cc1ccc(Nc2nc(Nc3cccc4c3C(=O)N(C)C4)ncc2C(F)(F)F)c(OC)c1)OCCOC |
| InChI | InChI=1S/C28H33F3N5O7P/c1-36-16-19-6-5-7-22(24(19)26(36)37)34-27-32-15-20(28(29,30)31)25(35-27)33-21-9-8-18(14-23(21)41-4)17-44(38,42-12-10-39-2)43-13-11-40-3/h5-9,14-15H,10-13,16-17H2,1-4H3,(H2,32,33,34,35) |
| InChIKey | HHCNIVOBYIKWBM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 133.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|