C24H26F3N4O6P — CID 58293009
2-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 58293009) has the molecular formula C24H26F3N4O6P and a molecular weight of 554.46 g/mol. Its IUPAC name is 2-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58293009 |
| Molecular Formula | C24H26F3N4O6P |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | CCOP(=O)(Cc1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccccc3C(=O)O)n2)c(OC)c1)OCC |
| InChI | InChI=1S/C24H26F3N4O6P/c1-4-36-38(34,37-5-2)14-15-10-11-19(20(12-15)35-3)30-23-28-13-17(24(25,26)27)21(31-23)29-18-9-7-6-8-16(18)22(32)33/h6-13H,4-5,14H2,1-3H3,(H,32,33)(H2,28,29,30,31) |
| InChIKey | UZOMFSTWDFGREK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|