C24H27BrF3N6O6P — CID 86697773
6-bromo-3-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methoxypyridine-2-carboxamide (PubChem CID 86697773) has the molecular formula C24H27BrF3N6O6P and a molecular weight of 663.39 g/mol. Its IUPAC name is 6-bromo-3-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methoxypyridine-2-carboxamide.
| Compound Name | 6-bromo-3-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methoxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 86697773 |
| Molecular Formula | C24H27BrF3N6O6P |
| Molecular Weight | 663.39 g/mol |
| Exact Mass | 662.09 |
| IUPAC Name | 6-bromo-3-[[2-[4-(diethoxyphosphorylmethyl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methoxypyridine-2-carboxamide |
| SMILES | CCOP(=O)(Cc1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccc(Br)nc3C(=O)NOC)n2)c(OC)c1)OCC |
| InChI | InChI=1S/C24H27BrF3N6O6P/c1-5-39-41(36,40-6-2)13-14-7-8-16(18(11-14)37-3)31-23-29-12-15(24(26,27)28)21(33-23)30-17-9-10-19(25)32-20(17)22(35)34-38-4/h7-12H,5-6,13H2,1-4H3,(H,34,35)(H2,29,30,31,33) |
| InChIKey | KDVBXKHMEHLPBX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.39 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|