C22H22BrF3N6O6P+ — CID 154037095
[4-[[4-[[6-bromo-2-(methoxycarbamoyl)-3-pyridinyl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenyl]methoxy-ethoxy-oxophosphanium (PubChem CID 154037095) has the molecular formula C22H22BrF3N6O6P+ and a molecular weight of 634.33 g/mol. Its IUPAC name is [4-[[4-[[6-bromo-2-(methoxycarbamoyl)-3-pyridinyl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenyl]methoxy-ethoxy-oxophosphanium.
| Compound Name | [4-[[4-[[6-bromo-2-(methoxycarbamoyl)-3-pyridinyl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenyl]methoxy-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 154037095 |
| Molecular Formula | C22H22BrF3N6O6P+ |
| Molecular Weight | 634.33 g/mol |
| Exact Mass | 633.05 |
| IUPAC Name | [4-[[4-[[6-bromo-2-(methoxycarbamoyl)-3-pyridinyl]amino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-methoxyphenyl]methoxy-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)OCc1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccc(Br)nc3C(=O)NOC)n2)c(OC)c1 |
| InChI | InChI=1S/C22H21BrF3N6O6P/c1-4-37-39(34)38-11-12-5-6-14(16(9-12)35-2)29-21-27-10-13(22(24,25)26)19(31-21)28-15-7-8-17(23)30-18(15)20(33)32-36-3/h5-10H,4,11H2,1-3H3,(H2-,27,28,29,31,32,33)/p+1 |
| InChIKey | NJZFNQUCVVYCFP-UHFFFAOYSA-O |
| XLogP | 5.65 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|