C23H25F3N5O4P — CID 166149995
4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-ethoxy-N-methoxybenzamide (PubChem CID 166149995) has the molecular formula C23H25F3N5O4P and a molecular weight of 523.45 g/mol. Its IUPAC name is 4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-ethoxy-N-methoxybenzamide.
| Compound Name | 4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-ethoxy-N-methoxybenzamide |
|---|---|
| PubChem CID | 166149995 |
| Molecular Formula | C23H25F3N5O4P |
| Molecular Weight | 523.45 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-3-ethoxy-N-methoxybenzamide |
| SMILES | CCOc1cc(C(=O)NOC)ccc1Nc1ncc(C(F)(F)F)c(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C23H25F3N5O4P/c1-5-35-18-12-14(21(32)31-34-2)10-11-16(18)29-22-27-13-15(23(24,25)26)20(30-22)28-17-8-6-7-9-19(17)36(3,4)33/h6-13H,5H2,1-4H3,(H,31,32)(H2,27,28,29,30) |
| InChIKey | CIDGDUUCBUABEN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|