C22H25ClN5O3P — CID 166150034
4-[[5-chloro-4-(2-diethylphosphorylanilino)pyrimidin-2-yl]amino]-N-methoxybenzamide (PubChem CID 166150034) has the molecular formula C22H25ClN5O3P and a molecular weight of 473.90 g/mol. Its IUPAC name is 4-[[5-chloro-4-(2-diethylphosphorylanilino)pyrimidin-2-yl]amino]-N-methoxybenzamide.
| Compound Name | 4-[[5-chloro-4-(2-diethylphosphorylanilino)pyrimidin-2-yl]amino]-N-methoxybenzamide |
|---|---|
| PubChem CID | 166150034 |
| Molecular Formula | C22H25ClN5O3P |
| Molecular Weight | 473.90 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 4-[[5-chloro-4-(2-diethylphosphorylanilino)pyrimidin-2-yl]amino]-N-methoxybenzamide |
| SMILES | CCP(=O)(CC)c1ccccc1Nc1nc(Nc2ccc(C(=O)NOC)cc2)ncc1Cl |
| InChI | InChI=1S/C22H25ClN5O3P/c1-4-32(30,5-2)19-9-7-6-8-18(19)26-20-17(23)14-24-22(27-20)25-16-12-10-15(11-13-16)21(29)28-31-3/h6-14H,4-5H2,1-3H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | YPDXGSFYLGCFRF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.90 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|