C22H23F3N5O3P — CID 166149992
4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-methoxy-3-methylbenzamide (PubChem CID 166149992) has the molecular formula C22H23F3N5O3P and a molecular weight of 493.43 g/mol. Its IUPAC name is 4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-methoxy-3-methylbenzamide.
| Compound Name | 4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-methoxy-3-methylbenzamide |
|---|---|
| PubChem CID | 166149992 |
| Molecular Formula | C22H23F3N5O3P |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-methoxy-3-methylbenzamide |
| SMILES | CONC(=O)c1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccccc3P(C)(C)=O)n2)c(C)c1 |
| InChI | InChI=1S/C22H23F3N5O3P/c1-13-11-14(20(31)30-33-2)9-10-16(13)28-21-26-12-15(22(23,24)25)19(29-21)27-17-7-5-6-8-18(17)34(3,4)32/h5-12H,1-4H3,(H,30,31)(H2,26,27,28,29) |
| InChIKey | USLLSGXZBXZAOE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|