C22H19F3N5O3P — CID 166150051
methyl 2-cyano-4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate (PubChem CID 166150051) has the molecular formula C22H19F3N5O3P and a molecular weight of 489.39 g/mol. Its IUPAC name is methyl 2-cyano-4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 2-cyano-4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 166150051 |
| Molecular Formula | C22H19F3N5O3P |
| Molecular Weight | 489.39 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | methyl 2-cyano-4-[[4-(2-dimethylphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccccc3P(C)(C)=O)n2)cc1C#N |
| InChI | InChI=1S/C22H19F3N5O3P/c1-33-20(31)15-9-8-14(10-13(15)11-26)28-21-27-12-16(22(23,24)25)19(30-21)29-17-6-4-5-7-18(17)34(2,3)32/h4-10,12H,1-3H3,(H2,27,28,29,30) |
| InChIKey | VHXCJNHFQQWZDP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|