C24H29F3N7OP — CID 163419796
4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 163419796) has the molecular formula C24H29F3N7OP and a molecular weight of 519.51 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163419796 |
| Molecular Formula | C24H29F3N7OP |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-[1-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)pyrazol-4-yl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CN1CC2CC(n3cc(Nc4ncc(C(F)(F)F)c(Nc5ccccc5P(C)(C)=O)n4)cn3)CC2C1 |
| InChI | InChI=1S/C24H29F3N7OP/c1-33-12-15-8-18(9-16(15)13-33)34-14-17(10-29-34)30-23-28-11-19(24(25,26)27)22(32-23)31-20-6-4-5-7-21(20)36(2,3)35/h4-7,10-11,14-16,18H,8-9,12-13H2,1-3H3,(H2,28,30,31,32) |
| InChIKey | AHMHHQJBKRVGDC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|