C20H25ClN7PS — CID 147777660
5-chloro-4-N-(2-dimethylphosphinothioylphenyl)-2-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidine-2,4-diamine (PubChem CID 147777660) has the molecular formula C20H25ClN7PS and a molecular weight of 461.96 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphinothioylphenyl)-2-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphinothioylphenyl)-2-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 147777660 |
| Molecular Formula | C20H25ClN7PS |
| Molecular Weight | 461.96 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphinothioylphenyl)-2-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidine-2,4-diamine |
| SMILES | CP(C)(=S)c1ccccc1Nc1nc(Nc2cnn(C3CCNCC3)c2)ncc1Cl |
| InChI | InChI=1S/C20H25ClN7PS/c1-29(2,30)18-6-4-3-5-17(18)26-19-16(21)12-23-20(27-19)25-14-11-24-28(13-14)15-7-9-22-10-8-15/h3-6,11-13,15,22H,7-10H2,1-2H3,(H2,23,25,26,27) |
| InChIKey | HHDVMKDIRLTIQN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.96 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|