C20H16BrF3N4O2 — CID 155463519
methyl 5-[[4-(benzylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-bromobenzoate (PubChem CID 155463519) has the molecular formula C20H16BrF3N4O2 and a molecular weight of 481.27 g/mol. Its IUPAC name is methyl 5-[[4-(benzylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-bromobenzoate.
| Compound Name | methyl 5-[[4-(benzylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-bromobenzoate |
|---|---|
| PubChem CID | 155463519 |
| Molecular Formula | C20H16BrF3N4O2 |
| Molecular Weight | 481.27 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | methyl 5-[[4-(benzylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-2-bromobenzoate |
| SMILES | COC(=O)c1cc(Nc2ncc(C(F)(F)F)c(NCc3ccccc3)n2)ccc1Br |
| InChI | InChI=1S/C20H16BrF3N4O2/c1-30-18(29)14-9-13(7-8-16(14)21)27-19-26-11-15(20(22,23)24)17(28-19)25-10-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3,(H2,25,26,27,28) |
| InChIKey | DZRWVRXFPDYHIS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.27 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |