C20H19BF3N5OS — CID 178080613
CID 178080613 (PubChem CID 178080613) has the molecular formula C20H19BF3N5OS and a molecular weight of 445.28 g/mol.
| Compound Name | CID 178080613 |
|---|---|
| PubChem CID | 178080613 |
| Molecular Formula | C20H19BF3N5OS |
| Molecular Weight | 445.28 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | — |
| SMILES | [B]Oc1ccc(Nc2ncc(C(F)(F)F)c(NCc3cccc(N(C)SC)c3)n2)cc1 |
| InChI | InChI=1S/C20H19BF3N5OS/c1-29(31-2)15-5-3-4-13(10-15)11-25-18-17(20(22,23)24)12-26-19(28-18)27-14-6-8-16(30-21)9-7-14/h3-10,12H,11H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | PKTLPHJOCBBCQG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.28 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|